|
|
| | 5-DesaMino 5-Oxo-2,5-dihydro LaMotrigine Basic information |
| Product Name: | 5-DesaMino 5-Oxo-2,5-dihydro LaMotrigine | | Synonyms: | LaMotrigine EP IMpurity-A (USP RC C);3-Amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-5(2H)-one;Lamotrigine impurity A (PhEur);Lamotrigine Related Compound C (USP);5-DesaMino 5-Oxo-2,5-dihydro LaMotrigine;3-AMino-6-(2,3-dichlorophenyl)-1,2,4-tryriazin-5(2H)-one;3-AMino-6-(2,3-dichlorophenyl)-1,2,4-tryriazin-5(4H)-one;3-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-5(4H)-one | | CAS: | 252186-78-0 | | MF: | C9H6Cl2N4O | | MW: | 257.08 | | EINECS: | | | Product Categories: | Amines, Heterocycles, Inhibitors, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals;Amines;Heterocycles;Impurities;Inhibitors;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 252186-78-0.mol |  |
| | 5-DesaMino 5-Oxo-2,5-dihydro LaMotrigine Chemical Properties |
| Boiling point | 412.1±55.0 °C(Predicted) | | density | 1.74±0.1 g/cm3(Predicted) | | solubility | Aqueous Base (Slightly), DMSO (Slightly), Methanol (Very Slightly) | | pka | 8.61±0.70(Predicted) | | form | powder | | Major Application | forensics and toxicology
pharmaceutical (small molecule) | | InChI | InChI=1S/C9H6Cl2N4O/c10-5-3-1-2-4(6(5)11)7-8(16)13-9(12)15-14-7/h1-3H,(H3,12,13,15,16) | | InChIKey | OVNGWOHWYFBGKF-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=CC(Cl)=C2Cl)C(=O)N=C(N)N1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2933690000 | | Storage Class | 11 - Combustible Solids |
| | 5-DesaMino 5-Oxo-2,5-dihydro LaMotrigine Usage And Synthesis |
| Uses | An impurity of the anticonvulsant Lamotrigine (L173250). |
| | 5-DesaMino 5-Oxo-2,5-dihydro LaMotrigine Preparation Products And Raw materials |
|