| Company Name: |
GLP Pharma Standards
|
| Tel: |
+91 9866074638 |
| Email: |
info@glppharmastandards.com |
| Products Intro: |
Product Name:Levothyroxine Beta Hydroxy Impurity
CAS:107849-54-7
Purity:NLT 95% Package:25 MG 50 MG 100 MG 250 MG EXTRA
|
| Company Name: |
Allas Chem Technologies Pvt Ltd
|
| Tel: |
+91-9902524108 |
| Email: |
krishna.alla@allaschemtech.com |
| Products Intro: |
Product Name:Levothyroxine-β-Hydroxy impurity
CAS:107849-54-7
Purity:97% Package:25 mg, 50 mg, 100 mg, 250 mg.
|
|
| | β-Hydroxy Thyroxine Basic information |
| | β-Hydroxy Thyroxine Chemical Properties |
| Melting point | >175°C (dec.) | | Boiling point | 627.4±55.0 °C(Predicted) | | density | 2.706±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 1.97±0.34(Predicted) | | color | White to Pale Beige | | InChI | InChI=1/C15H11I4NO5/c16-7-3-6(4-8(17)13(7)22)25-14-9(18)1-5(2-10(14)19)12(21)11(20)15(23)24/h1-4,11-12,21-22H,20H2,(H,23,24)/t11-,12/s3 | | InChIKey | QIFVILYTCIFAPL-BJWPUJNWNA-N | | SMILES | c1(O)c(I)cc(Oc2c(I)cc(C(O)[C@@H](C(=O)O)N)cc2I)cc1I |&1:14,r| |
| | β-Hydroxy Thyroxine Usage And Synthesis |
| Uses | It has been prepared for testing as possible antithyroid. It showed some thyromimetic activity. | | Uses | O-(4-Hydroxy-3,5-diiodophenyl)-3,5-diiodo-b-hydroxy-L-tyrosine is a Levothyroxine impurity of Thyroxine (T425600), which is one of the thyroid hormones involved in the maintenance of metabolic homeostasis. Thyroxine is deiodinated in peripheral tissues to the active metabolite, liothyronine, which has been used to treat hyperlipidemia. |
| | β-Hydroxy Thyroxine Preparation Products And Raw materials |
|