Methyl 6-broMo-4-chloronicotinate manufacturers
|
| | Methyl 6-broMo-4-chloronicotinate Basic information |
| Product Name: | Methyl 6-broMo-4-chloronicotinate | | Synonyms: | Methyl 6-broMo-4-chloronicotinate;3-Pyridinecarboxylic acid, 6-bromo-4-chloro-, methyl ester;chloronicotinate;methyl 6-;methyl 6-bromo-4-chloropyridine-3-carboxylate | | CAS: | 1256789-73-7 | | MF: | C7H5BrClNO2 | | MW: | 250.48 | | EINECS: | | | Product Categories: | | | Mol File: | 1256789-73-7.mol |  |
| | Methyl 6-broMo-4-chloronicotinate Chemical Properties |
| Melting point | 68 - 71°C | | Boiling point | 301.9±37.0 °C(Predicted) | | density | 1.684±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly) | | pka | -1.24±0.10(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C7H5BrClNO2/c1-12-7(11)4-3-10-6(8)2-5(4)9/h2-3H,1H3 | | InChIKey | ZEASAUSJELNJFI-UHFFFAOYSA-N | | SMILES | C1=NC(Br)=CC(Cl)=C1C(OC)=O |
| | Methyl 6-broMo-4-chloronicotinate Usage And Synthesis |
| Uses | Methyl 6-Bromo-4-chloronicotinate can be used as TNFα and IRAK4 inhibitors. |
| | Methyl 6-broMo-4-chloronicotinate Preparation Products And Raw materials |
|