|
|
| | 1-Piperidinecarboxylic acid, 4-amino-3-hydroxy-, 1,1-dimethylethyl ester, (3R,4R)-rel- Basic information |
| Product Name: | 1-Piperidinecarboxylic acid, 4-amino-3-hydroxy-, 1,1-dimethylethyl ester, (3R,4R)-rel- | | Synonyms: | trans-4-AMino-1-Boc-3-hydroxypiperidine;(3R,4R)-rel-tert-Butyl 4-amino-3-hydroxypiperidine-1-carboxylate;tert-butyl (trans-4-amino-3-hydroxypiperidine-1-carboxylate;trans-tert-Butyl 4-amino-3-hydroxypiperidine-1-carboxylate;Trans-4-Amino-1-Boc-3-Hydroxypiperidine（WX601146）;trans-1-Boc-4-amino-3-hydroxy-piperidine;tert-butyl trans-4-amino-3-hydroxy-1-piperidinecarboxylate;1-Piperidinecarboxylic acid, 4-amino-3-hydroxy-, 1,1-dimethylethyl ester, (3R,4R)-rel- | | CAS: | 443955-98-4 | | MF: | C10H20N2O3 | | MW: | 216.28 | | EINECS: | | | Product Categories: | | | Mol File: | 443955-98-4.mol |  |
| | 1-Piperidinecarboxylic acid, 4-amino-3-hydroxy-, 1,1-dimethylethyl ester, (3R,4R)-rel- Chemical Properties |
| Boiling point | 326.1±42.0 °C(Predicted) | | density | 1.142±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 14.37±0.40(Predicted) | | Appearance | white solid/yellow liquid/colorless liquid | | InChI | InChI=1/C10H20N2O3/c1-10(2,3)15-9(14)12-5-4-7(11)8(13)6-12/h7-8,13H,4-6,11H2,1-3H3/t7-,8-/s3 | | InChIKey | KREUZCYJWPQPJX-KWTCHIRYNA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC[C@@H](N)[C@H](O)C1 |&1:10,12,r| |
| | 1-Piperidinecarboxylic acid, 4-amino-3-hydroxy-, 1,1-dimethylethyl ester, (3R,4R)-rel- Usage And Synthesis |
| | 1-Piperidinecarboxylic acid, 4-amino-3-hydroxy-, 1,1-dimethylethyl ester, (3R,4R)-rel- Preparation Products And Raw materials |
|