| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 2-benzyloxy-5-Methylphenyl boronicacid pinacol ester Basic information |
| Product Name: | 2-benzyloxy-5-Methylphenyl boronicacid pinacol ester | | Synonyms: | 2-(2-Benzyloxy-5-methylphenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane;2-benzyloxy-5-Methylphenyl boronicacid pinacol ester;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[5-methyl-2-(phenylmethoxy)phenyl]-;4,4,5,5-Tetramethyl-2-[5-methyl-2-(phenylmethoxy)phenyl]-1,3,2-dioxaborolane;2-Benzyloxy-5-methylphenylboronic acid pinacol ester - [B5463];2-(Benzyloxy)-5-methylbenzeneboronic acid pinacol ester;4,4,5,5-Tetramethyl-2-[5-methyl-2-(benzyloxy)phenyl]-1,3,2-dioxaborolane | | CAS: | 1204580-85-7 | | MF: | C20H25BO3 | | MW: | 324.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1204580-85-7.mol |  |
| | 2-benzyloxy-5-Methylphenyl boronicacid pinacol ester Chemical Properties |
| storage temp. | Store at Room Tem. | | form | solid | | InChI | 1S/C20H25BO3/c1-15-11-12-18(22-14-16-9-7-6-8-10-16)17(13-15)21-23-19(2,3)20(4,5)24-21/h6-13H,14H2,1-5H3 | | InChIKey | VEPULHNEQKEFFW-UHFFFAOYSA-N | | SMILES | Cc1ccc(OCc2ccccc2)c(c1)B3OC(C)(C)C(C)(C)O3 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-benzyloxy-5-Methylphenyl boronicacid pinacol ester Usage And Synthesis |
| Uses | 2-(2-Benzyloxy-5-methylphenyl)-4,4,5,5-tetramethyl[1,3,2]dioxaborolane is a useful synthetic intermediate. |
| | 2-benzyloxy-5-Methylphenyl boronicacid pinacol ester Preparation Products And Raw materials |
|