|
|
| | 1-(4-Bromo-thiophen-2-yl)-2,2,2-trifluoro-ethanone Basic information |
| | 1-(4-Bromo-thiophen-2-yl)-2,2,2-trifluoro-ethanone Chemical Properties |
| Boiling point | 258.2±40.0 °C(Predicted) | | density | 1.811±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C6H2BrF3OS/c7-3-1-4(12-2-3)5(11)6(8,9)10/h1-2H | | InChIKey | FRLDQRVGRGTWAL-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(=O)c1[s]cc(c1)Br |
| Hazard Codes | Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-(4-Bromo-thiophen-2-yl)-2,2,2-trifluoro-ethanone Usage And Synthesis |
| | 1-(4-Bromo-thiophen-2-yl)-2,2,2-trifluoro-ethanone Preparation Products And Raw materials |
|