| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:4'-(2-Fluorophenoxy)acetophenone CAS:58775-91-0 Purity:97% Package:5g, 25g
|
| Company Name: |
Wuhan Chemwish Technology Co., Ltd
|
| Tel: |
86-027-67849912 |
| Email: |
sales@chemwish.com |
| Products Intro: |
Product Name:4'-(2-Fluorophenoxy)acetophenone CAS:58775-91-0 Purity:98% Package:1g;5g;25g;50g;100g;500g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:1-(4-(2-Fluorophenoxy)phenyl)ethanone CAS:58775-91-0 Purity:1-(4-(2-Fluorophenoxy)phenyl)ethanone Package:1G Remarks:JRD1292-1G
|
|
| | 4'-(2-FLUOROPHENOXY)ACETOPHENONE Basic information |
| Product Name: | 4'-(2-FLUOROPHENOXY)ACETOPHENONE | | Synonyms: | 4'-(2-FLUOROPHENOXY)ACETOPHENONE;1-(4-(2-Fluorophenoxy)phenyl)ethanone;JR-13424, 1-(4-(2-Fluorophenoxy)phenyl)ethanone, 97%;Ethanone, 1-[4-(2-fluorophenoxy)phenyl]-;4′-(2-Fluorophenoxy)acetophenone, CAS 58775-91-0 | | CAS: | 58775-91-0 | | MF: | C14H11FO2 | | MW: | 230.23 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4'-(2-FLUOROPHENOXY)ACETOPHENONE Chemical Properties |
| Melting point | 55-58°C | | form | solid | | InChI | 1S/C14H11FO2/c1-10(16)11-6-8-12(9-7-11)17-14-5-3-2-4-13(14)15/h2-9H,1H3 | | InChIKey | PMTIXDASSQPMGP-UHFFFAOYSA-N | | SMILES | CC(C1=CC=C(OC2=CC=CC=C2F)C=C1)=O |
| WGK Germany | WGK 3 | | HS Code | 2914790090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 4'-(2-FLUOROPHENOXY)ACETOPHENONE Usage And Synthesis |
| | 4'-(2-FLUOROPHENOXY)ACETOPHENONE Preparation Products And Raw materials |
|