| Company Name: |
Nanjing XiZe Biotechnology CO., Ltd. Gold
|
| Tel: |
025-66023220 15250997978 |
| Email: |
1511893459@qq.com |
| Products Intro: |
Product Name:Bambuterol EP Impurity D CAS:112935-93-0 Purity:95% HPLC Package:10mg;25mg;50mg;100mg;250mg;500mg;1g
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:5-Des[2-(tert-butylaMino)] BaMbuterol-5-ethanol CAS:112935-93-0 Package:250Mg,25g
|
|
| | 5-Des[2-(tert-butylaMino)] BaMbuterol-5-ethanol Basic information |
| Product Name: | 5-Des[2-(tert-butylaMino)] BaMbuterol-5-ethanol | | Synonyms: | 5-Des[2-(tert-butylaMino)] BaMbuterol-5-ethanol;1-Bis-[3',5'-(N,N-diMethylcarbaMoyloxy)phenyl Etanol;DiMethylcarbaMic Acid 5-(1-Hydroxyethyl)-1,3-phenylene Ester;Bambuterol impurity 4;Bambuterol Impurity D (EP);Bambuterol EP Impurity D;5-[(1RS)-1-Hydroxyethyl]-1,3-phenyl;Carbamic acid, dimethyl-, 5-(1-hydroxyethyl)-1,3-phenylene ester (9CI) | | CAS: | 112935-93-0 | | MF: | C14H20N2O5 | | MW: | 296.32 | | EINECS: | | | Product Categories: | Amines, Aromatics, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals;Amines;Aromatics;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 112935-93-0.mol | ![5-Des[2-(tert-butylaMino)] BaMbuterol-5-ethanol Structure](CAS/GIF/112935-93-0.gif) |
| | 5-Des[2-(tert-butylaMino)] BaMbuterol-5-ethanol Chemical Properties |
| solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Gel | | color | Colourless | | InChI | InChI=1S/C14H20N2O5/c1-9(17)10-6-11(20-13(18)15(2)3)8-12(7-10)21-14(19)16(4)5/h6-9,17H,1-5H3 | | InChIKey | GSPOTIPIYTUHQP-UHFFFAOYSA-N | | SMILES | C1(OC(=O)N(C)C)=CC(C(O)C)=CC(OC(=O)N(C)C)=C1 |
| | 5-Des[2-(tert-butylaMino)] BaMbuterol-5-ethanol Usage And Synthesis |
| Uses | Bambuterol (B117500) impurity. |
| | 5-Des[2-(tert-butylaMino)] BaMbuterol-5-ethanol Preparation Products And Raw materials |
|