| Company Name: |
Yaopu(Shanghai) Pharmaceutical Technology Co., Ltd Gold
|
| Tel: |
021-50929289 18616309303 |
| Email: |
sales@ypptech.com.cn |
| Products Intro: |
Product Name:tert-Butyl 3-azabicyclo[3.2.1]octan-8-ylcarbamate CAS:198210-17-2 Purity:98% Package:10g;100g;500g;1kg;10kg
|
tert-butyl (1R,8S)-3-azabicyclo[3.2.1]octan-8-ylcarbaMate manufacturers
|
| | tert-butyl (1R,8S)-3-azabicyclo[3.2.1]octan-8-ylcarbaMate Basic information |
| Product Name: | tert-butyl (1R,8S)-3-azabicyclo[3.2.1]octan-8-ylcarbaMate | | Synonyms: | tert-butyl (1R,8S)-3-azabicyclo[3.2.1]octan-8-ylcarbaMate;8-(Boc-aMino)-3-azabicyclo[3.2.1]octane;(3-Aza-bicyclo[3.2.1]oct-8-yl)-carbamic acid tert-butyl ester;tert-butyl N-[(1R,5S)-3-azabicyclo[3.2.1]octan-8-yl]carbamate;8-(Boc-ami)-3-azabicyclo[3.2.1]octane;Carbamic acid, 3-azabicyclo[3.2.1]oct-8-yl-, 1,1-dimethylethyl ester (9CI);tert-Butyl n-(3-azabicyclo[3.2.1]octan-8-yl)carbamate;Carbamic acid, N-3-azabicyclo[3.2.1]oct-8-yl-, 1,1-dimethylethyl ester | | CAS: | 198210-17-2 | | MF: | C12H22N2O2 | | MW: | 226.32 | | EINECS: | | | Product Categories: | | | Mol File: | 198210-17-2.mol | ![tert-butyl (1R,8S)-3-azabicyclo[3.2.1]octan-8-ylcarbaMate Structure](CAS/GIF/198210-17-2.gif) |
| | tert-butyl (1R,8S)-3-azabicyclo[3.2.1]octan-8-ylcarbaMate Chemical Properties |
| Boiling point | 339.8±31.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 12.23±0.20(Predicted) | | Appearance | white solid | | InChI | InChI=1S/C12H22N2O2/c1-12(2,3)16-11(15)14-10-8-4-5-9(10)7-13-6-8/h8-10,13H,4-7H2,1-3H3,(H,14,15) | | InChIKey | HHYUNZXSGVNMOY-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1C2CCC1CNC2 |
| | tert-butyl (1R,8S)-3-azabicyclo[3.2.1]octan-8-ylcarbaMate Usage And Synthesis |
| | tert-butyl (1R,8S)-3-azabicyclo[3.2.1]octan-8-ylcarbaMate Preparation Products And Raw materials |
|