| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl 2-fluoro-5-nitrobenzoate Basic information |
| Product Name: | Methyl 2-fluoro-5-nitrobenzoate | | Synonyms: | RARECHEM AL BF 0280;methyl 2-fluoro-5-nitrobenzenecarboxylate;5-nitro-2-fluorobenzoic acid methyl ester;4-Fluoro-3-(Methoxycarbonyl)nitrobenzene;Benzoic acid, 2-fluoro-5-nitro-, methyl ester;Methyl2-fluoro-5-nitrobenzoate,98%;Methyl 2-fluoro-5-nitrobenzoate | | CAS: | 2965-22-2 | | MF: | C8H6FNO4 | | MW: | 199.14 | | EINECS: | | | Product Categories: | | | Mol File: | 2965-22-2.mol |  |
| | Methyl 2-fluoro-5-nitrobenzoate Chemical Properties |
| Melting point | 49-51℃ | | Boiling point | 303℃ | | density | 1.388 | | Fp | 137℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Solid | | color | White to Yellow to Green | | InChI | 1S/C8H6FNO4/c1-14-8(11)6-4-5(10(12)13)2-3-7(6)9/h2-4H,1H3 | | InChIKey | JZLONOOYIXEAHM-UHFFFAOYSA-N | | SMILES | [O-][N+](C1=CC=C(C(C(OC)=O)=C1)F)=O |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Methyl 2-fluoro-5-nitrobenzoate Usage And Synthesis |
| Synthesis | General procedure for the synthesis of methyl 2-fluoro-5-nitrobenzoate from methanol and 2-fluoro-5-nitrobenzoic acid:
1. dissolve 2-fluoro-5-nitrobenzoic acid (3.7 g, 20.0 mmol) in methanol (100 mL) at 0 °C.
2. Slowly add thionyl chloride (5.3 mL, 60.0 mmol) dropwise.
3. The reaction mixture was heated to reflux for 24 hours.
4. Upon completion of the reaction, the solvent was removed by vacuum concentration. 5.
5. The residue was dissolved in ethyl acetate and washed several times with 1.0 M NaOH solution.
6. The organic phase was dried with anhydrous sodium sulfate and the solvent was evaporated in vacuum to give the intermediate methyl 2-fluoro-5-nitrobenzoate (Intermediate 37) as a yellow oil, which crystallized into light yellow needle crystals after standing.
Yield: 90%;
Melting point: 47-49°C;
1H NMR (300MHz, CDCl3) δ= 4.01 (s, 3H, OCH3), 7.35 (t, 1H, H3,3JH3.H4 = 3JH3.F = 9.2Hz), 8.44 (dt, 1H, 3JH4-H3 = 9.2Hz, 4JH4.F = 4JH4-H6 = 3.5Hz), 8.87 (dd, 1H. 4JH6-F = 5.9 Hz, 4JH6-H4 = 2.7 Hz);
13C NMR (75 MHz, CDCl3): δ= 47.7 (OCH3), 113.2 (d, C3,2JC-F = 25.1 Hz), 114.5 (d, C1, 2JC-F = 12.0 Hz), 122.9 (d, C6,3JC-F = 3.3 Hz), 124.3 (d, C4,3JC-F = 10.9 Hz ), 138.6 (C5), 157.4 (d, COOCH3,3JC-F = 3.8 Hz), 159.8 (d, C2,1JC-F = 269.0 Hz). | | References | [1] Patent: WO2012/85003, 2012, A1. Location in patent: Page/Page column 83-84 [2] Journal of Medicinal Chemistry, 2014, vol. 57, # 11, p. 4640 - 4660 [3] Patent: EP3192791, 2017, A1. Location in patent: Paragraph 0467 [4] Patent: WO2009/80836, 2009, A2. Location in patent: Page/Page column 70 [5] Patent: WO2004/92124, 2004, A2. Location in patent: Page 77 |
| | Methyl 2-fluoro-5-nitrobenzoate Preparation Products And Raw materials |
|