|
|
| | 1-(4-Bromophenyl)-2-phenylbenzimidazole Basic information | | Uses |
| Product Name: | 1-(4-Bromophenyl)-2-phenylbenzimidazole | | Synonyms: | 1H-BenziMidazole, 1-(4-broMophenyl)-2-phenyl;1-(4-broMophenyl)-2-phenyl-1H-benzo[d]iMidazole;1-(4-BroMo-phenyl)-2-phenyl-1H-benzoiMidazole;1-(4-Bromophenyl)-2-phenyl-1H-benzimidazole;1-(4-bromophenyl)-2-phenyl-1H-benzo[d]imidazole1;1-(4-Bromophenyl)-2-phenyl-1H-1,3-benzodiazole;1-(4-Bromophenyl)-2-phenylbenzimidazole;2-1H-BenziMidazole, 1-(4-broMophenyl)-2-phenyl | | CAS: | 760212-58-6 | | MF: | C19H13BrN2 | | MW: | 349.22 | | EINECS: | 208-028-7 | | Product Categories: | OLED | | Mol File: | 760212-58-6.mol |  |
| | 1-(4-Bromophenyl)-2-phenylbenzimidazole Chemical Properties |
| Melting point | 135.0 to 139.0 °C | | Boiling point | 503.5±52.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.85±0.10(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C19H13BrN2/c20-15-10-12-16(13-11-15)22-18-9-5-4-8-17(18)21-19(22)14-6-2-1-3-7-14/h1-13H | | InChIKey | PPYIZNYOMNYZCG-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)N(C2=CC=C(Br)C=C2)C2=CC=CC=C2N=1 |
| | 1-(4-Bromophenyl)-2-phenylbenzimidazole Usage And Synthesis |
| Uses | 1-(4-bromophenyl)-2-phenyl-1H-benzo[d]imidazole is a useful research chemical. | | Uses | 1-(4-Bromophenyl)-2-phenylbenzimidazole is a phosphorescent organic semiconductor. It can be used in devices such as light emitting diodes and organic solar cells, which are based on the electroluminescence of materials that emit light when electrically stimulated. 1-(4-Bromophenyl)-2-phenylbenzimidazole has been shown to exhibit efficient electron and ionic transport properties, both in cyclic voltammetry and in thin film transistors. | | Synthesis | 1-(4-Bromophenyl)-2-phenylbenzimidazole can be synthesized using tert-butylchloroformate, benzaldehyde, and 4-bromobenzaldehyde in a cyclic reaction with potassium tert-butoxide as the catalyst. The product is purified by recrystallization from acetone. | | References | [1] Patent: US9548460, 2017, B2. Location in patent: Page/Page column 80; 82 [2] Patent: EP1734038, 2006, A1. Location in patent: Page/Page column 47 [3] Patent: EP1602648, 2005, A1. Location in patent: Page/Page column 36 [4] Patent: EP2524913, 2012, A1. Location in patent: Page/Page column 31 [5] Patent: EP2530071, 2012, A1. Location in patent: Page/Page column 28-29 |
| | 1-(4-Bromophenyl)-2-phenylbenzimidazole Preparation Products And Raw materials |
|