|
|
| | (S)-tert-butyl 3-(2-Hydroxyethyl)piperazine-1-carboxylate Basic information |
| Product Name: | (S)-tert-butyl 3-(2-Hydroxyethyl)piperazine-1-carboxylate | | Synonyms: | (S)-tert-butyl 3-(2-Hydroxyethyl)piperazine-1-carboxylate;(S)-1-N-Boc-3-hydroxyethyl piperazine;(3S)-3-(2-Hydroxyethyl)-1-piperazinecarboxylic acid 1,1-dimethylethyl ester;1-Piperazinecarboxylic acid, 3-(2-hydroxyethyl)-, 1,1-dimethylethyl ester, (3S)-;tert-butyl (3S)-3-(2-hydroxyethyl)piperazine-1-carboxylate;(S)-1-Boc-3-(2-hydroxyethyl)piperazine;tert-butyl (3S)-3-(2-hydroxyethyl)piperazine-1-carboxylate - [B82172];(S)-2-(4-Boc-2-piperazinyl)ethanol | | CAS: | 1273577-11-9 | | MF: | C11H22N2O3 | | MW: | 230.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1273577-11-9.mol |  |
| | (S)-tert-butyl 3-(2-Hydroxyethyl)piperazine-1-carboxylate Chemical Properties |
| Boiling point | 352.2±22.0 °C(Predicted) | | density | 1.067±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 15.11±0.10(Predicted) | | Appearance | Colorless to off-white Solid-Liquid Mixture | | Optical Rotation | -12.53°(C=0.01 g/mL MeOH) | | InChI | InChI=1S/C11H22N2O3/c1-11(2,3)16-10(15)13-6-5-12-9(8-13)4-7-14/h9,12,14H,4-8H2,1-3H3/t9-/m0/s1 | | InChIKey | FPQSSQQQKLJLPA-VIFPVBQESA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCN[C@@H](CCO)C1 |
| | (S)-tert-butyl 3-(2-Hydroxyethyl)piperazine-1-carboxylate Usage And Synthesis |
| | (S)-tert-butyl 3-(2-Hydroxyethyl)piperazine-1-carboxylate Preparation Products And Raw materials |
|