|
|
| | Quinine sulfate dihydrate Basic information |
| | Quinine sulfate dihydrate Chemical Properties |
| Melting point | ~225 °C (dec.)(lit.) | | alpha | -245 º (c=2, 0.1M HCl) | | FEMA | 2977 | QUININE SULFATE | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | solubility | Soluble in a mixture of chloroform and absolute alcohol (2:1). | | form | Crystalline Powder | | color | Light yellow or beige to brown | | Odor | odorless | | Odor Type | odorless | | Water Solubility | 0.12 g/100 mL (20 ºC) | | Sensitive | Light Sensitive | | Merck | 14,8061 | | BRN | 6113937 | | Stability: | Stable. Incompatible with strong oxidizing agents, alkalies, ammonia, strong bases, iodine. | | InChIKey | AKYHKWQPZHDOBW-QJLYHTAINA-N | | SMILES | [C@H]([C@]1([H])C[C@@H]2CC[N@]1C[C@@H]2C=C)(C1=CC=NC2=CC=C(OC)C=C12)O.S(O)(O)(=O)=O |&1:0,1,4,7,9,r| | | LogP | 3.44 | | CAS DataBase Reference | 6119-70-6(CAS DataBase Reference) |
| | Quinine sulfate dihydrate Usage And Synthesis |
| Chemical Properties | White or almost white, crystalline powder or fine, colourless needles. | | Chemical Properties | Quinine sulfate is odorless and has a persistent, very bitter taste. It darkens on exposure to light. Its saturated solution is neutral or alkaline to litmus. | | Uses | Primary alkaloid of various species of Cinchona (Rubiaceae). Optical isomer of Quinidine. Antimalarial; muscle relaxant (skeletal). | | Uses | Quinine sulfate is an antimalarial agent also used as antipyreticum and in liquids (tonic etc.). | | Uses | Quinine hemisulfate monohydrate plays a major role in potassium channel blockers. It is also used as an antimalarial, anticholinergic, antihypertensive and a hypoglycemic agent. It inhibits mitochondrial ATP-regulated potassium channel. It is also used to study the metabolism of biocrystalized heme, hemozoin, in malarial parasites and to study the toxicity of heme (FP)-complexes. | | Brand name | Coco-Quinine (Lilly). | | Synthesis | Manufacture of quinine by extraction from cinchona bark and subsequent purification and synthesis to quinine sulfate |
| | Quinine sulfate dihydrate Preparation Products And Raw materials |
|