1-ACETYL-1-CYCLOHEXENE manufacturers
|
| | 1-ACETYL-1-CYCLOHEXENE Basic information |
| | 1-ACETYL-1-CYCLOHEXENE Chemical Properties |
| Melting point | 73 °C | | Boiling point | 201-202 °C(lit.) | | density | 0.966 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.49(lit.) | | Fp | 150 °F | | storage temp. | Storage temp. 2-8°C | | form | Liquid | | color | Clear slightly yellow | | InChI | InChI=1S/C8H12O/c1-7(9)8-5-3-2-4-6-8/h5H,2-4,6H2,1H3 | | InChIKey | LTYLUDGDHUEBGX-UHFFFAOYSA-N | | SMILES | C(=O)(C1CCCCC=1)C | | LogP | 1.648 (est) | | CAS DataBase Reference | 932-66-1 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29142990 | | Storage Class | 10 - Combustible liquids |
| | 1-ACETYL-1-CYCLOHEXENE Usage And Synthesis |
| Chemical Properties | CLEAR SLIGHTLY YELLOW LIQUID | | Synthesis Reference(s) | Organic Syntheses, Coll. Vol. 3, p. 22, 1955 The Journal of Organic Chemistry, 48, p. 2503, 1983 DOI: 10.1021/jo00163a015 Tetrahedron Letters, 16, p. 925, 1975 DOI: 10.1016/S0040-4039(00)72021-1 |
| | 1-ACETYL-1-CYCLOHEXENE Preparation Products And Raw materials |
|