|
|
| | 1H-Pyrrole-3-carboxylic acid, 5-Methyl-, Methyl ester Basic information |
| | 1H-Pyrrole-3-carboxylic acid, 5-Methyl-, Methyl ester Chemical Properties |
| Melting point | 118 °C(Solv: ligroine (8032-32-4)) | | Boiling point | 296.5±20.0 °C(Predicted) | | density | 1.141±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 16.14±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H9NO2/c1-5-3-6(4-8-5)7(9)10-2/h3-4,8H,1-2H3 | | InChIKey | RGLRQDCBEOTJOG-UHFFFAOYSA-N | | SMILES | N1C(C)=CC(C(OC)=O)=C1 |
| | 1H-Pyrrole-3-carboxylic acid, 5-Methyl-, Methyl ester Usage And Synthesis |
| | 1H-Pyrrole-3-carboxylic acid, 5-Methyl-, Methyl ester Preparation Products And Raw materials |
|