|
|
| | 2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate Basic information |
| Product Name: | 2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate | | Synonyms: | 2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate;ethyl 2-Methyl-2-(4-(4;ethyl 2-Methyl-2-(4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate;1H-Pyrazole-1-acetic acid, α,α-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester;ethyl 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate;ethyl 2-methyl-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazol-1-yl)propanoate - [E17389] | | CAS: | 1201657-32-0 | | MF: | C15H25BN2O4 | | MW: | 308.18 | | EINECS: | | | Product Categories: | | | Mol File: | 1201657-32-0.mol |  |
| | 2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate Chemical Properties |
| Boiling point | 406.2±25.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 1.53±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H25BN2O4/c1-8-20-12(19)13(2,3)18-10-11(9-17-18)16-21-14(4,5)15(6,7)22-16/h9-10H,8H2,1-7H3 | | InChIKey | FIXNVGDENQNXPD-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(C)(N1C=C(B2OC(C)(C)C(C)(C)O2)C=N1)C |
| | 2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate Usage And Synthesis |
| Uses | Ethyl 2-Methyl-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate is used as a reactant in the preparation of inhibitors that overcome the G1202R anaplastic lymphoma kinase resistance mutation. |
| | 2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate Preparation Products And Raw materials |
|