|
|
| | 2-Methoxy-4-nitrophenol Basic information |
| | 2-Methoxy-4-nitrophenol Chemical Properties |
| Melting point | 102-104 °C(lit.) | | Boiling point | 298.4°C (rough estimate) | | density | 1.4523 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Powder | | pka | 7.05±0.22(Predicted) | | color | Yellow | | Water Solubility | insoluble | | Major Application | diagnostic assay manufacturing hematology histology | | Cosmetics Ingredients Functions | HAIR DYEING | | InChI | InChI=1S/C7H7NO4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4,9H,1H3 | | InChIKey | IZLVFLOBTPURLP-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C([N+]([O-])=O)C=C1OC | | CAS DataBase Reference | 3251-56-7(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Nitroguaiacol(3251-56-7) | | EPA Substance Registry System | Phenol, 2-methoxy-4-nitro- (3251-56-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 3 | | RTECS | SL7800000 | | TSCA | TSCA listed | | HS Code | 29095000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Methoxy-4-nitrophenol Usage And Synthesis |
| Chemical Properties | YELLOW POWDER | | Uses | 4-Nitroguaiacol (cas# 3251-56-7) is a compound useful in organic synthesis. Dyes and metabolites. | | Uses | A novel 4-nitroguaiacol-degrading actinobacterium. | | Definition | ChEBI: 2-Methoxy-4-nitrophenol is a member of 4-nitrophenols. | | Synthesis Reference(s) | Journal of the American Chemical Society, 113, p. 8970, 1991 DOI: 10.1021/ja00023a069 |
| | 2-Methoxy-4-nitrophenol Preparation Products And Raw materials |
|