| Company Name: |
Pharmalego Gold |
| Tel: |
18321033991 |
| Email: |
marketing@pharmalego.com |
|
| | 1-(2,4-bis(benzyloxy)phenyl)ethanone Basic information |
| Product Name: | 1-(2,4-bis(benzyloxy)phenyl)ethanone | | Synonyms: | 1-(2,4-bis(benzyloxy)phenyl)ethanone;Terbutaline Impurity 26;2',4'-Bis(benzyloxy)acetophenone;Ethanone,1-[2,4-bis(phenylMethoxy)phenyl]-;1-(2,4-bis(benzyloxy)phenyl)ethan-1-one;1-(2,4-Bis benzyloxy-phenyl)-ethanonoe;1-[2,4-bis(phenylmethoxy)phenyl]ethanone;4-benzyl-5-(2-(tert-butylamino)-1-hydroxyethyl)benzene-1,3-diol | | CAS: | 22877-01-6 | | MF: | C22H20O3 | | MW: | 332.39 | | EINECS: | | | Product Categories: | | | Mol File: | 22877-01-6.mol |  |
| | 1-(2,4-bis(benzyloxy)phenyl)ethanone Chemical Properties |
| Melting point | 81 - 83°C | | Boiling point | 511.5±40.0 °C(Predicted) | | density | 1.144±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C22H20O3/c1-17(23)21-13-12-20(24-15-18-8-4-2-5-9-18)14-22(21)25-16-19-10-6-3-7-11-19/h2-14H,15-16H2,1H3 | | InChIKey | FYUABHFDUHJWOZ-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(OCC2=CC=CC=C2)C=C1OCC1=CC=CC=C1)C |
| | 1-(2,4-bis(benzyloxy)phenyl)ethanone Usage And Synthesis |
| Preparation | Obtained by reaction of benzyl bromide with resacetophenone in the presence of potassium carbonate in refluxing acetonitrile for 18 h (97%). |
| | 1-(2,4-bis(benzyloxy)phenyl)ethanone Preparation Products And Raw materials |
|