|
|
| | 3-Azaspiro[5.5]undec-7-ene-3-carboxylic acid, 9-oxo-, 1,1-diMethylethyl ester Basic information |
| Product Name: | 3-Azaspiro[5.5]undec-7-ene-3-carboxylic acid, 9-oxo-, 1,1-diMethylethyl ester | | Synonyms: | 3-Azaspiro[5.5]undec-7-ene-3-carboxylic acid, 9-oxo-, 1,1-diMethylethyl ester;tert-butyl 9-oxo-3-azaspiro[5.5]undec-7-ene-3-carboxylate;tert-Butyl 9-oxo-3-azaspiro[5.5]undeca-7-ene-3-carboxylate;EOS-60496;tert-butyl 9-oxo-3-azaspiro[5.5]undec-10-ene-3-carboxylate;3-Boc-3-azaspiro[5.5]undec-7-en-9-one;1,1-Dimethylethyl 9-oxo-3-azaspiro[5.5]undec-7-ene-3-carboxylate;4,4'-(heptane-1,7-diylbis(oxy))dibenzimidamidedimethanesulfonate | | CAS: | 873924-07-3 | | MF: | C15H23NO3 | | MW: | 265.35 | | EINECS: | | | Product Categories: | | | Mol File: | 873924-07-3.mol | ![3-Azaspiro[5.5]undec-7-ene-3-carboxylic acid, 9-oxo-, 1,1-diMethylethyl ester Structure](CAS/GIF/873924-07-3.gif) |
| | 3-Azaspiro[5.5]undec-7-ene-3-carboxylic acid, 9-oxo-, 1,1-diMethylethyl ester Chemical Properties |
| Boiling point | 110-120 °C(Press: 0.02 Torr) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -0.81±0.20(Predicted) | | InChI | InChI=1S/C15H23NO3/c1-14(2,3)19-13(18)16-10-8-15(9-11-16)6-4-12(17)5-7-15/h4,6H,5,7-11H2,1-3H3 | | InChIKey | QAHLORULIOPMFV-UHFFFAOYSA-N | | SMILES | C1C2(CCC(=O)C=C2)CCN(C(OC(C)(C)C)=O)C1 |
| | 3-Azaspiro[5.5]undec-7-ene-3-carboxylic acid, 9-oxo-, 1,1-diMethylethyl ester Usage And Synthesis |
| | 3-Azaspiro[5.5]undec-7-ene-3-carboxylic acid, 9-oxo-, 1,1-diMethylethyl ester Preparation Products And Raw materials |
|