- Diisooctyl maleate
-
- $1.00 / 1KG
-
2020-01-03
- CAS:1330-76-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KGS
|
| | Diisooctyl maleate Basic information |
| Product Name: | Diisooctyl maleate | | Synonyms: | 2-Butenedioicacid(Z)-,diisooctylester;(Z)-2-Butenedioic acid bis(6-methylheptyl) ester;Maleic acid di(6-methylheptyl) ester;Bis(6-methylheptyl) maleate;diisooctylester;diom;maleicacid,diisooctylester;rccomonomerdiom | | CAS: | 1330-76-3 | | MF: | C20H36O4 | | MW: | 340.5 | | EINECS: | 215-547-2 | | Product Categories: | monomer | | Mol File: | 1330-76-3.mol |  |
| | Diisooctyl maleate Chemical Properties |
| InChI | InChI=1S/C20H36O4/c1-17(2)11-7-5-9-15-23-19(21)13-14-20(22)24-16-10-6-8-12-18(3)4/h13-14,17-18H,5-12,15-16H2,1-4H3/b14-13- | | InChIKey | QIGLLCHDIZAZFE-YPKPFQOOSA-N | | SMILES | C(=O)(OCCCCCC(C)C)/C=C\C(=O)OCCCCCC(C)C | | CAS DataBase Reference | 1330-76-3(CAS DataBase Reference) | | EPA Substance Registry System | Diisooctyl maleate (1330-76-3) |
| | Diisooctyl maleate Usage And Synthesis |
| | Diisooctyl maleate Preparation Products And Raw materials |
|