|
|
| | 6-broMo-8-Methoxyquinoline Basic information |
| | 6-broMo-8-Methoxyquinoline Chemical Properties |
| Boiling point | 70-80 °C(Press: 24 Torr) | | density | 1.516±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.49±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H8BrNO/c1-13-9-6-8(11)5-7-3-2-4-12-10(7)9/h2-6H,1H3 | | InChIKey | JXXVYYHNERBSBL-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(Br)=CC=2OC)C=CC=1 |
| | 6-broMo-8-Methoxyquinoline Usage And Synthesis |
| Uses | 6-Bromo-8-methoxyquinoline is a novel quinoline derivative which may also contain anticancer activity. |
| | 6-broMo-8-Methoxyquinoline Preparation Products And Raw materials |
|