|
|
| | BenzenesulfonaMide, 2,5-diMethoxy-N-3-quinolinyl- Basic information |
| | BenzenesulfonaMide, 2,5-diMethoxy-N-3-quinolinyl- Chemical Properties |
| Boiling point | 564.1±60.0 °C(Predicted) | | density | 1.356±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 50mg/mL | | pka | 7.48±0.30(Predicted) | | form | solid | | color | white | | InChI | 1S/C17H16N2O4S/c1-22-14-7-8-16(23-2)17(10-14)24(20,21)19-13-9-12-5-3-4-6-15(12)18-11-13/h3-11,19H,1-2H3 | | InChIKey | JZSPHTPWUXNQGB-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(Nc2cnc3c(c2)cccc3)c1c(ccc(c1)OC)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | BenzenesulfonaMide, 2,5-diMethoxy-N-3-quinolinyl- Usage And Synthesis |
| Uses | TNAP-IN-1 (Compound 1) is a selective tissue-nonspecific alkaline phosphatase (TNAP) inhibitor, with an IC50 of 0.19 μM. TNAP-IN-1 can be used for the research of soft tissue calcification[1]. | | Definition | ChEBI: 2,5-dimethoxy-N-(3-quinolinyl)benzenesulfonamide is a member of quinolines. | | References | [1] Dahl R, et al. Discovery and validation of a series of aryl sulfonamides as selective inhibitors of tissue-nonspecific alkaline phosphatase (TNAP). J Med Chem. 2009 Nov 12;52(21):6919-25. DOI:10.1021/jm900383s |
| | BenzenesulfonaMide, 2,5-diMethoxy-N-3-quinolinyl- Preparation Products And Raw materials |
|