| Company Name: |
INNOVATIVE LABS
|
| Tel: |
+91-9885794886 +91-9885794886 |
| Email: |
innovativelabs9@gmail.com |
| Products Intro: |
Product Name:n-Boc-2-Azidoethylamin
CAS:117861-38-8
Purity:99% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
Neochemsys Laboratories Pvt Ltd
|
| Tel: |
+918498007788 |
| Email: |
praveen@neochemsys.com |
| Products Intro: |
Product Name:N-Boc-2-azidoethylamine
CAS:117861-38-8
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| | N-Boc-2-azidoethylaMine Basic information | | Uses |
| Product Name: | N-Boc-2-azidoethylaMine | | Synonyms: | N-Boc-2-azidoethylaMine;tert-Butyl n-(2-azidoethyl)carbamate;tert-butyl 2-azidoethylcarbamate;Carbamic acid, (2-azidoethyl)-, 1,1-dimethylethyl ester;N-(2-azidoethyl)pivalamide;N-(2-Azidoethyl)-carbamic acid 1,1-dimethylethyl ester;N-Boc-2-azidoethylamine - [B73528];n-Boc-2-Azidoethylamin | | CAS: | 117861-38-8 | | MF: | C7H14N4O2 | | MW: | 186.22 | | EINECS: | | | Product Categories: | | | Mol File: | 117861-38-8.mol |  |
| | N-Boc-2-azidoethylaMine Chemical Properties |
| storage temp. | Store at Room Tem. | | Appearance | yellow liquid | | InChI | InChI=1S/C7H14N4O2/c1-7(2,3)13-6(12)9-4-5-10-11-8/h4-5H2,1-3H3,(H,9,12) | | InChIKey | KHZVCESAQNHHKR-UHFFFAOYSA-N | | SMILES | C(=O)(OC(C)(C)C)NCCN=[N+]=[N-] |
| | N-Boc-2-azidoethylaMine Usage And Synthesis |
| Uses | N-BOC-2-azidoethylamine is a useful research chemical for organic synthesis and other chemical processes. |
| | N-Boc-2-azidoethylaMine Preparation Products And Raw materials |
|