|
|
| | 2-Ethyl-1,3-cyclopentanedione Basic information |
| Product Name: | 2-Ethyl-1,3-cyclopentanedione | | Synonyms: | 2-Ehtyl-1,3-Cyclopentanedione;2-ETHYLCYCLOPENTAN-1,3-DIONE;2-Ethylcyclopentane-1,3-dione;2-ETHYL-1,3-CYCLOPENTANEDIONE;2-ETHYL-1,3-CYCLOPENTANEDIONE(ETHYLCYCLE-D);1,3-Cyclopentanedione, 2-ethyl-;2-Ethyl-1,3-cyclopentanedione,99%;2-Ethyl-1 | | CAS: | 823-36-9 | | MF: | C7H10O2 | | MW: | 126.15 | | EINECS: | 212-512-3 | | Product Categories: | Miscellaneous;ketone | | Mol File: | 823-36-9.mol |  |
| | 2-Ethyl-1,3-cyclopentanedione Chemical Properties |
| Melting point | 172-175 °C | | Boiling point | 194.28°C (rough estimate) | | density | 1.0579 (rough estimate) | | refractive index | 1.4660 (estimate) | | storage temp. | Store at room temperature | | solubility | soluble in Methanol | | pka | 10.87±0.20(Predicted) | | form | powder to crystal | | color | White to Light yellow | | PH | 2.94 at 24.3℃ and 10g/L | | BRN | 1860068 | | InChI | InChI=1S/C7H10O2/c1-2-5-6(8)3-4-7(5)9/h5H,2-4H2,1H3 | | InChIKey | YDFBIBUYOUFJMR-UHFFFAOYSA-N | | SMILES | C1(=O)CCC(=O)C1CC | | LogP | 0.3 at 30℃ and pH7.69 | | CAS DataBase Reference | 823-36-9(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3-Cyclopentanedione, 2-ethyl-(823-36-9) |
| Safety Statements | 24/25 | | HS Code | 2914290090 |
| | 2-Ethyl-1,3-cyclopentanedione Usage And Synthesis |
| Chemical Properties | off-white to yellow-beige crystalline powder |
| | 2-Ethyl-1,3-cyclopentanedione Preparation Products And Raw materials |
|