- 1-chloro-4-iodobenzene
-
- $60.00 / 1KG
-
2026-02-03
- CAS:637-87-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 300MT/year
- 1-Chloro-4-iodobenzene
-
- $100.00 / 1KG
-
2025-09-25
- CAS:637-87-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1-Chloro-4-iodobenzene Basic information |
| | 1-Chloro-4-iodobenzene Chemical Properties |
| Melting point | 53-54 °C(lit.) | | Boiling point | 226-227 °C(lit.) | | density | 1.8860 | | Fp | 227 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly, Heated) | | form | Crystalline Powder or Crystals | | color | Off-white to light beige | | Sensitive | Light Sensitive | | BRN | 1634414 | | InChI | InChI=1S/C6H4ClI/c7-5-1-3-6(8)4-2-5/h1-4H | | InChIKey | GWQSENYKCGJTRI-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(I)C=C1 | | CAS DataBase Reference | 637-87-6(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-chloro-4-iodo-(637-87-6) | | EPA Substance Registry System | Benzene, 1-chloro-4-iodo- (637-87-6) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 36/37-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | 1-Chloro-4-iodobenzene Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | suzuki reaction | | Uses | 4-Chloroiodobenzene is used as a reagent in the synthesis of Clothiapine (C588550); an atypical antipsychotic of the dibenzothiazepine chemical class that has shown efficacy in treatment-resistant schizophrenic patients. | | Purification Methods | Distil it in a vacuum then recrystallise it from EtOH. [Sugden J Chem Soc 1173 1924, Beilstein 5 H 221, 5 III 579, 5 IV 695.] |
| | 1-Chloro-4-iodobenzene Preparation Products And Raw materials |
|