|
|
| | tert-butyl 2-oxopiperazine-1-carboxylate Basic information |
| Product Name: | tert-butyl 2-oxopiperazine-1-carboxylate | | Synonyms: | Piperazin-2-one, N1-BOC protected;tert-butyl 2-oxopiperazine-1-carboxylate;1-Boc-2-oxopiperazine;1-Piperazinecarboxylic acid, 2-oxo-, 1,1-dimethylethyl ester;tert-butyl 2-oxopiperazine-1-carboxylate - [B87782] | | CAS: | 889958-14-9 | | MF: | C9H16N2O3 | | MW: | 200.23 | | EINECS: | | | Product Categories: | | | Mol File: | 889958-14-9.mol |  |
| | tert-butyl 2-oxopiperazine-1-carboxylate Chemical Properties |
| Boiling point | 339.8±35.0 °C(Predicted) | | density | 1.129±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | liquid | | pka | 7.27±0.20(Predicted) | | color | Colourless | | InChI | InChI=1S/C9H16N2O3/c1-9(2,3)14-8(13)11-5-4-10-6-7(11)12/h10H,4-6H2,1-3H3 | | InChIKey | SORUSJZOKKMNQS-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNCC1=O |
| | tert-butyl 2-oxopiperazine-1-carboxylate Usage And Synthesis |
| | tert-butyl 2-oxopiperazine-1-carboxylate Preparation Products And Raw materials |
|