|
|
| | Bromotris(dimethylamino)phosphonium hexafluorophosphate Basic information |
| Product Name: | Bromotris(dimethylamino)phosphonium hexafluorophosphate | | Synonyms: | BROMOTRIS(DIMETHYLAMINO)PHOSPHONIUM HEXAFLUOROPHOSPHATE;BROP;Bromotris(dimethylamino)phosphoniumHexafluorophos;BROMO-TRIS(DIMETHYLAMINO)PHOSPHONIUM HEXAFLUOROPHOSPHATE (BROP);BROP BROMOTRIS(DIMETHYLAMINO)PHOSPHONIUM HEXAFLUOROPHOSPHATE;Bromotris(dimethylamino)phosphonium hexafluorophosphate, 98+% (AT);Bromotris(dimethylamino)phosphonium hexafluorophosphate, 98+%;bromotris(dimethylamino)phosphonium hexafluorophosphate(V) | | CAS: | 50296-37-2 | | MF: | C6H18BrF6N3P2 | | MW: | 388.07 | | EINECS: | | | Product Categories: | | | Mol File: | 50296-37-2.mol |  |
| | Bromotris(dimethylamino)phosphonium hexafluorophosphate Chemical Properties |
| Melting point | >300 °C(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | color | White to Almost white | | Sensitive | Light Sensitive | | Major Application | peptide synthesis | | InChI | InChI=1S/C6H18BrN3P.F6P/c1-8(2)11(7,9(3)4)10(5)6;1-7(2,3,4,5)6/h1-6H3;/q+1;-1 | | InChIKey | XELPBWPBGHCIKX-UHFFFAOYSA-N | | SMILES | [P-](F)(F)(F)(F)(F)F.[P+](Br)(N(C)C)(N(C)C)N(C)C | | CAS DataBase Reference | 50296-37-2(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 45-34 | | Safety Statements | 53-26-36/37/39-45 | | RIDADR | UN 3263 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29299090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Carc. 1B
Skin Corr. 1B |
| | Bromotris(dimethylamino)phosphonium hexafluorophosphate Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Reagent for:
Conjugate addition of nitroalkanes to an acrylate equivalent
A novel polymer supported approach to nucleoside modification
Asymmetric hydrogenations
Peptide coupling
Pyrrolidine hydroxylation
Synthesis of cyclic PNA-based compound directed against HIV-1 TAR RNA | | reaction suitability | reaction type: Coupling Reactions |
| | Bromotris(dimethylamino)phosphonium hexafluorophosphate Preparation Products And Raw materials |
|