- 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22,25,28-octaoxa-4-azahentriacontan-31-oic acid
-
- $0.00 / 1g
-
2026-02-05
- CAS:1334177-86-4
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
- Mal-NH-PEG8-CH2CH2COOH
-
- $0.00 / 1g
-
2026-01-29
- CAS:1334177-86-4
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 500kg
|
| | Mal-PEG8-COOH Basic information |
| Product Name: | Mal-PEG8-COOH | | Synonyms: | Mal-PEG8-COOH;1-Maleimido-3-oxo-7,10,13,16,19,22,25,28-octaoxa-4-aza-hentriacontan-31-oic acid;MALEIMIDE-NH-PEG8-CH2CH2COOH;Mal-amido-PEG8-acid;Maleimide-PEG8-propionic acid;31-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-29-oxo-4,7,10,13,16,19,22,25-octaoxa-28-azahentriacontanoic Acid;MAL-AMIDO-PEG8-COOH;Mal-NH-PEG8-COOH | | CAS: | 1334177-86-4 | | MF: | C26H44N2O13 | | MW: | 592.63 | | EINECS: | | | Product Categories: | Monodispersed PEG Derivatives;PEGylation Reagents;peg | | Mol File: | 1334177-86-4.mol |  |
| | Mal-PEG8-COOH Chemical Properties |
| Boiling point | 747.9±60.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Storage temp. -20°C | | pka | 4.28±0.10(Predicted) | | form | Solid-Liquid Mixture | | color | Colorless to off-white | | InChIKey | ARKUDJPBDMAVBL-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| | Mal-PEG8-COOH Usage And Synthesis |
| Description | Mal-amido-PEG8-acid is a PEG linker containing a maleimide group and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. | | Uses | 31-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-29-oxo-4,7,10,13,16,19,22,25-octaoxa-28-azahentriacontanoic Acid is reactant in the light-induced endosomal lysis events in fibroblast, normal, and carcinoma cell lines using a colloidal mesoporous silica (CMS) nanoparticle. | | IC 50 | Non-cleavable Linker |
| | Mal-PEG8-COOH Preparation Products And Raw materials |
|