|
|
| | 1-(2-isopropylthiazol-4-yl-N-MethylMethanaMine Basic information | | Application |
| Product Name: | 1-(2-isopropylthiazol-4-yl-N-MethylMethanaMine | | Synonyms: | 2-Isopropyl-4(((N-Methyl) aMino)Methyl)thiazole dihydrochloride;1-(2-isopropylthiazol-4-yl)-N-MethylMethanaMine dihydrochloride;4-Thiazolemethanamine, N-methyl-2-(1-methylethyl)-, hydrochloride (1:2);2-ISOPROPYL-4(((N-METHYL) AMINO)METHYL)THIAZOLE 2HCL;N-Methyl-2-(1-Methylethyl)-4-thiazoleMethanaMine dihydrochloride;2-Isopropyl-7-(((N-Methyl)aMino)Methyl)thiozolehydrochloride;N-Methyl-2-(1-Methylethyl)-4-thiazoleMethanaMine;2-Isopropyl-4-(N-MethylaMinoMethyl)thiazole Hydrochloride salt(1:2) | | CAS: | 1185167-55-8 | | MF: | C8H15ClN2S | | MW: | 206.73 | | EINECS: | 937-695-3 | | Product Categories: | | | Mol File: | 1185167-55-8.mol |  |
| | 1-(2-isopropylthiazol-4-yl-N-MethylMethanaMine Chemical Properties |
| Melting point | >155°C (dec.) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Pale Beige | | InChI | InChI=1S/C8H14N2S.ClH/c1-6(2)8-10-7(4-9-3)5-11-8;/h5-6,9H,4H2,1-3H3;1H | | InChIKey | MZHCXYATKCSZHX-UHFFFAOYSA-N | | SMILES | C(C1SC=C(CNC)N=1)(C)C.Cl |
| | 1-(2-isopropylthiazol-4-yl-N-MethylMethanaMine Usage And Synthesis |
| Application | 2-Isopropyl-4-(((N-methyl)-amino)-methyl)thiazole dihydrochloride is used as an organic synthesis intermediate and a pharmaceutical intermediate. | | Synthesis | Using 2-methylthiopropionamide as raw material, 4-(chloromethyl)-2-isopropylthiazole was obtained by condensation with 1,3-dichloroacetone, and then N-methyl-2-isopropyl-4-thiazole methanamine dihydrochloride was obtained by substitution reaction with methylamine.
|
| | 1-(2-isopropylthiazol-4-yl-N-MethylMethanaMine Preparation Products And Raw materials |
|