- 9-Me-BC
-
- $150.00/ g
-
2026-05-04
- CAS:2521-07-5
- Min. Order: 10g
- Purity: 99%
- Supply Ability: 9999
|
| | 9-Methyl-9H-beta-carboline Basic information |
| Product Name: | 9-Methyl-9H-beta-carboline | | Synonyms: | 9-Methyl-9H-beta-carboline;9-methyl-9H-pyrido[3,4-b]indole;9-Methyl-9H-pyrido[3,4-b]indole;9-Methyl-9H-β-carboline;9-Me-BC/9-methyl-9H-pyrido[3,4-b]indole;9-me-bc;9-methylpyrido[3,4-b]indole;9-Methyl-b-carboline | | CAS: | 2521-07-5 | | MF: | C12H10N2 | | MW: | 182.22 | | EINECS: | 251-228-4 | | Product Categories: | pharmaceutical | | Mol File: | 2521-07-5.mol |  |
| | 9-Methyl-9H-beta-carboline Chemical Properties |
| Melting point | 105.0 to 109.0 °C | | Boiling point | 367.3±24.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | solubility | DMF: 20 mg/ml; DMSO: 20 mg/ml; DMSO:PBS (pH 7.2) (1:3): 0.33 mg/ml | | form | powder to crystal | | pka | 8.21±0.30(Predicted) | | color | White to Yellow to Green | | λmax | 361nm(Cyclohexane)(lit.) | | InChI | InChI=1S/C12H10N2/c1-14-11-5-3-2-4-9(11)10-6-7-13-8-12(10)14/h2-8H,1H3 | | InChIKey | MABOIYXDALNSES-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(C=CC=C2)C2C=CN=CC1=2 |
| | 9-Methyl-9H-beta-carboline Usage And Synthesis |
| Description | 9-Methyl-9H-beta-carboline is a heterocyclic amine of the β-carboline family, and a research chemical. It is a methylated derivative of β-carboline with the molecular formula C12H10N2. | | Uses | 9-Methyl-β-carboline is an analytical reference standard categorized as a nootropic. 9-Methyl-β-carboline improves spatial learning in rats. This product is intended for research and forensic applications. | | Preparation | 9-Methyl-β-carboline may be prepared by performing the Eschweiler–Clarke reaction on freebase β-carboline (norharmane). |
| | 9-Methyl-9H-beta-carboline Preparation Products And Raw materials |
|