|
|
| | (3R)-Hexahydro-3-methyl-1H-1,4-diazepine-1-carboxylic acid tert-butyl ester Basic information |
| Product Name: | (3R)-Hexahydro-3-methyl-1H-1,4-diazepine-1-carboxylic acid tert-butyl ester | | Synonyms: | (3R)-Hexahydro-3-methyl-1H-1,4-diazepine-1-carboxylic acid tert-butyl ester;tert-butyl (R)-3-methyl-1,4-diazepane-1-carboxylate;2-Methyl-2-propanyl(3R)-3-methyl-1,4-diazepane-1-carboxylate;tert-Butyl (3R)-3-methyl-1,4-diazepane-1-carboxylate;(R)-tert-butyl 3-Methyl-1,4-diazepane-1-carboxylate;(R)-1-Boc-3-methyl-[1,4]diazepane;1H-1,4-Diazepine-1-carboxylic acid, hexahydro-3-methyl-, 1,1-dimethylethyl ester, (3R)-;(3R)-Hexahydro-3-methyl-1H-1,4-diazepine-1-carboxylic acid tert-butyl este | | CAS: | 223644-10-8 | | MF: | C11H22N2O2 | | MW: | 214.3 | | EINECS: | | | Product Categories: | | | Mol File: | 223644-10-8.mol |  |
| | (3R)-Hexahydro-3-methyl-1H-1,4-diazepine-1-carboxylic acid tert-butyl ester Chemical Properties |
| Boiling point | 288℃ | | density | 0.980 | | Fp | 128℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C11H22N2O2/c1-9-8-13(7-5-6-12-9)10(14)15-11(2,3)4/h9,12H,5-8H2,1-4H3/t9-/m1/s1 | | InChIKey | GDTFCUXOVITPHU-SECBINFHSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCCN[C@H](C)C1 |
| | (3R)-Hexahydro-3-methyl-1H-1,4-diazepine-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| | (3R)-Hexahydro-3-methyl-1H-1,4-diazepine-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|