|
|
| | tert-Butyl ((4,5-diMethoxypyridin-3-yl)Methyl)carbaMate Basic information |
| | tert-Butyl ((4,5-diMethoxypyridin-3-yl)Methyl)carbaMate Chemical Properties |
| Boiling point | 398.7±42.0 °C(Predicted) | | density | 1.109±0.06 g/cm3(Predicted) | | pka | 11.00±0.46(Predicted) | | form | solid | | InChI | 1S/C13H20N2O4/c1-13(2,3)19-12(16)15-7-9-6-14-8-10(17-4)11(9)18-5/h6,8H,7H2,1-5H3,(H,15,16) | | InChIKey | QLZIMMWYZWGOFP-UHFFFAOYSA-N | | SMILES | COc1cncc(CNC(=O)OC(C)(C)C)c1OC |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | tert-Butyl ((4,5-diMethoxypyridin-3-yl)Methyl)carbaMate Usage And Synthesis |
| | tert-Butyl ((4,5-diMethoxypyridin-3-yl)Methyl)carbaMate Preparation Products And Raw materials |
|