|
|
| | 4-broMo-2-iodo-1-nitrobenzene Basic information |
| Product Name: | 4-broMo-2-iodo-1-nitrobenzene | | Synonyms: | 4-broMo-2-iodo-1-nitrobenzene;4-BroMo-2-iodonitrobenzene;Benzene, 4-bromo-2-iodo-1-nitro-;1-Bromo-3-iodo-4-nitrobenzene;2-Iodo-4-bromonitrobenzene | | CAS: | 343864-78-8 | | MF: | C6H3BrINO2 | | MW: | 327.9 | | EINECS: | | | Product Categories: | | | Mol File: | 343864-78-8.mol |  |
| | 4-broMo-2-iodo-1-nitrobenzene Chemical Properties |
| storage temp. | 2-8°C(protect from light) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C6H3BrINO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H | | InChIKey | VWDMDPDGACOPSR-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC=C(Br)C=C1I |
| | 4-broMo-2-iodo-1-nitrobenzene Usage And Synthesis |
| Uses | 4-Bromo-2-iodo-1-nitrobenzene is a derivative compound of Nitrobenzene (N493000), which is used mainly in the production of the chemical precursor aniline. |
| | 4-broMo-2-iodo-1-nitrobenzene Preparation Products And Raw materials |
|