|
|
| | 3-Hydroxy-DL-kynurenine-(butyric-1,2-13C2) dihydrobroMide Basic information |
| | 3-Hydroxy-DL-kynurenine-(butyric-1,2-13C2) dihydrobroMide Chemical Properties |
| Melting point | -235°C (lit.) | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C10H12N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,13H,4,11-12H2,(H,15,16)/i6+1,10+1 | | InChIKey | VCKPUUFAIGNJHC-UFYQYTSASA-N | | SMILES | N[13CH](CC(=O)c1cccc(O)c1N)[13C](O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Hydroxy-DL-kynurenine-(butyric-1,2-13C2) dihydrobroMide Usage And Synthesis |
| Uses | 3-Hydroxy-DL-kynurenine-13C2 is a labelled impurity of Kynurenine, which is a tryptophan metabolite and a precursor of kynurenic acid, which is an antagonist of N-methyl-aspartate receptor. An amino acid produced in the body from tryptophan. |
| | 3-Hydroxy-DL-kynurenine-(butyric-1,2-13C2) dihydrobroMide Preparation Products And Raw materials |
|