|
|
| | 9-Bromo-7,7-dimethyl-7H-benzo[c]fluorene Basic information |
| Product Name: | 9-Bromo-7,7-dimethyl-7H-benzo[c]fluorene | | Synonyms: | 9-Bromo-7,7-dimethyl-7H-benzo[c]fluorene;7H-Benzo[c]fluorene, 9-bromo-7,7-dimethyl-;9-Bromo-7,7-dimethyl-7H-benzo[c]fluorene;9-Bromo-7,7-dimethyl-benzofluorene;9-Bromo-7,7-dimethyl-benzo[c]fluorene;9-Bromo-7,7-dimethyl-7Hbenzo[c]fluorine;2-BDMF2N;9-bromo-7,7'-dimethylbenz[a]fluorene | | CAS: | 1198396-46-1 | | MF: | C19H15Br | | MW: | 323.23 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 1198396-46-1.mol | ![9-Bromo-7,7-dimethyl-7H-benzo[c]fluorene Structure](CAS/20150408/GIF/1198396-46-1.gif) |
| | 9-Bromo-7,7-dimethyl-7H-benzo[c]fluorene Chemical Properties |
| Melting point | 105.0 to 109.0 °C | | Boiling point | 445℃ | | density | 1.363 | | Fp | 219℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C19H15Br/c1-19(2)16-10-7-12-5-3-4-6-14(12)18(16)15-9-8-13(20)11-17(15)19/h3-11H,1-2H3 | | InChIKey | SNUKBTHMZLUJKR-UHFFFAOYSA-N | | SMILES | C1(C)(C)C2=C(C=CC(Br)=C2)C2=C1C=CC1=CC=CC=C12 |
| | 9-Bromo-7,7-dimethyl-7H-benzo[c]fluorene Usage And Synthesis |
| | 9-Bromo-7,7-dimethyl-7H-benzo[c]fluorene Preparation Products And Raw materials |
|