|
|
| | tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate Basic information |
| Product Name: | tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate | | Synonyms: | tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate;2-oxo-1,8-Diazaspiro[4.5]decane-8-carboxylic acid 1,1-dimethylethyl ester;tert-Butyl 2-BR>oxo-BR>1,8-BR>diazaspiro[4.5]BR>decane-BR>8-BR>carboxylate;8-Boc-1,8-diazaspiro[4.5]decan-2-one;1,8-Diazaspiro[4.5]decane-8-carboxylic acid, 2-oxo-, 1,1-dimethylethyl ester;tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate - [B16836] | | CAS: | 1158749-94-0 | | MF: | C13H22N2O3 | | MW: | 254.33 | | EINECS: | | | Product Categories: | | | Mol File: | 1158749-94-0.mol | ![tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate Structure](CAS/20150408/GIF/1158749-94-0.gif) |
| | tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate Chemical Properties |
| Boiling point | 424.9±38.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 16.21±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C13H22N2O3/c1-12(2,3)18-11(17)15-8-6-13(7-9-15)5-4-10(16)14-13/h4-9H2,1-3H3,(H,14,16) | | InChIKey | MHBGZEDGKJRVPB-UHFFFAOYSA-N | | SMILES | O=C(CC1)NC21CCN(C(OC(C)(C)C)=O)CC2 |
| HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate Usage And Synthesis |
| | tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate Preparation Products And Raw materials |
|