|
|
| | Tert-Butyl 4-(oxetan-3-yl)piperazine-1-carboxylate Basic information |
| | Tert-Butyl 4-(oxetan-3-yl)piperazine-1-carboxylate Chemical Properties |
| form | solid | | InChI | 1S/C12H22N2O3/c1-12(2,3)17-11(15)14-6-4-13(5-7-14)10-8-16-9-10/h10H,4-9H2,1-3H3 | | InChIKey | BZORURUBWYXNAX-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2COC2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2933599590 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | Tert-Butyl 4-(oxetan-3-yl)piperazine-1-carboxylate Usage And Synthesis |
| | Tert-Butyl 4-(oxetan-3-yl)piperazine-1-carboxylate Preparation Products And Raw materials |
|