| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-MethoxypicoliniMidaMide hydrochloride Basic information |
| | 4-MethoxypicoliniMidaMide hydrochloride Chemical Properties |
| Melting point | 174-176 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | powder or solid | | InChI | InChI=1S/C7H9N3O.ClH/c1-11-5-2-3-10-6(4-5)7(8)9;/h2-4H,1H3,(H3,8,9);1H | | InChIKey | JOUDWIBACXLPIO-UHFFFAOYSA-N | | SMILES | C(C1N=CC=C(OC)C=1)(N)=N.Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-MethoxypicoliniMidaMide hydrochloride Usage And Synthesis |
| Uses | This pyridyl carboxamidine ligand has been demonstrated by Daniel Weix′s lab to enable nickel-catalyzed cross-coupling of diverse basic nitrogen heterocycles with primary and secondary alkyl halides. | | reaction suitability | core: nickel reaction type: Cross Couplings reagent type: catalyst |
| | 4-MethoxypicoliniMidaMide hydrochloride Preparation Products And Raw materials |
|