| Company Name: |
SunaTech Inc. |
| Tel: |
0512-62872180 18994314770 |
| Email: |
sales@sunatech.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,5-DibroMo-3-(2-ethylhexyl)thiophene Basic information |
| | 2,5-DibroMo-3-(2-ethylhexyl)thiophene Chemical Properties |
| Boiling point | 343.1±37.0 °C(Predicted) | | density | 1.454±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | liquid | | InChI | 1S/C12H18Br2S/c1-3-5-6-9(4-2)7-10-8-11(13)15-12(10)14/h8-9H,3-7H2,1-2H3 | | InChIKey | DFUZDCATNROZQR-UHFFFAOYSA-N | | SMILES | BrC1=C(CC(CC)CCCC)C=C(Br)S1 |
| RIDADR | UN 2810 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Skin Irrit. 2 |
| | 2,5-DibroMo-3-(2-ethylhexyl)thiophene Usage And Synthesis |
| Uses | Organic semiconducting polymer or small molecule precursor. |
| | 2,5-DibroMo-3-(2-ethylhexyl)thiophene Preparation Products And Raw materials |
|