|
|
| | Diphenylethyne-3,3',5,5'-tetracarboxylic acid Basic information |
| Product Name: | Diphenylethyne-3,3',5,5'-tetracarboxylic acid | | Synonyms: | Diphenylethyne-3,3',5,5'-tetracarboxylic acid;1,1′-ethynebenzene-3,3′,5,5,′-tetracarboxylic acid;5,5'-(Ethyne-1,2-diyl)diisophthalic acid;1,3-Benzenedicarboxylic acid, 5,5'-(1,2-ethynediyl)bis-;DK7234;DK7674;Ethynylbiphenyl-3,3',5,5'-tetracarboxylic acid;1,1'-ethynebenzene-3,3',5,5'-tetracarboxylic acid | | CAS: | 957014-38-9 | | MF: | C18H10O8 | | MW: | 354.27 | | EINECS: | | | Product Categories: | | | Mol File: | 957014-38-9.mol |  |
| | Diphenylethyne-3,3',5,5'-tetracarboxylic acid Chemical Properties |
| Melting point | >350 °C | | Boiling point | 783.292±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.708±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at room temperature | | pka | 2.936±0.10(predicted) | | Appearance | Off-white to gray Solid | | InChI | InChI=1S/C18H10O8/c19-15(20)11-3-9(4-12(7-11)16(21)22)1-2-10-5-13(17(23)24)8-14(6-10)18(25)26/h3-8H,(H,19,20)(H,21,22)(H,23,24)(H,25,26) | | InChIKey | YFRIPYPPJIRELM-UHFFFAOYSA-N | | SMILES | C(C1C=C(C(O)=O)C=C(C(O)=O)C=1)#CC1C=C(C(O)=O)C=C(C(O)=O)C=1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Diphenylethyne-3,3',5,5'-tetracarboxylic acid Usage And Synthesis |
| | Diphenylethyne-3,3',5,5'-tetracarboxylic acid Preparation Products And Raw materials |
|