| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 6-BroMo-2H-1,4-benzothiazin-3(4H)-one, 97% Basic information |
| Product Name: | 6-BroMo-2H-1,4-benzothiazin-3(4H)-one, 97% | | Synonyms: | 6-BroMo-2H-1,4-benzothiazin-3(4H)-one, 97%;6-Bromo-2H-benzo[b][1,4]thiazin-3(4H)-one;6-bromo-4H-1,4-benzothiazin-3-one;2H-1,4-Benzothiazin-3(4H)-one, 6-bromo-;6-Bromo-2H-benzo[b][1,4]thiazin-3(4H)-one;6-BroMo-2H-1,4-benzothiazin-3(4H)-one, 97% | | CAS: | 98434-22-1 | | MF: | C8H6BrNOS | | MW: | 244.11 | | EINECS: | | | Product Categories: | | | Mol File: | 98434-22-1.mol |  |
| | 6-BroMo-2H-1,4-benzothiazin-3(4H)-one, 97% Chemical Properties |
| Melting point | 206 °C(Solv: ethanol (64-17-5)) | | Boiling point | 394.7±42.0 °C(Predicted) | | density | 1.689±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 12.17±0.20(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C8H6BrNOS/c9-5-1-2-7-6(3-5)10-8(11)4-12-7/h1-3H,4H2,(H,10,11) | | InChIKey | QXMFOFHASVVZIT-UHFFFAOYSA-N | | SMILES | BrC1=CC=C2C(NC(CS2)=O)=C1 |
| Risk Statements | 52 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3 |
| | 6-BroMo-2H-1,4-benzothiazin-3(4H)-one, 97% Usage And Synthesis |
| | 6-BroMo-2H-1,4-benzothiazin-3(4H)-one, 97% Preparation Products And Raw materials |
|