|
|
| | 3,3-DIMETHYLGLUTARIC ANHYDRIDE Basic information |
| Product Name: | 3,3-DIMETHYLGLUTARIC ANHYDRIDE | | Synonyms: | 3,3-DiMethylglutaric anhydride, 99% 25GR;3,3-DiMethylglutaric anhydride, 99% 5GR;2H-Pyran-2,6(3H)-dione, dihydro-4,4-diMethyl-;3,3'-DIMETHYL GLUTARIC ANHYDRIDE;3,3-DIMETHYLGLUTARIC ANHYDRIDE;BETA-BETA-DIMETHYLGLUTARIC ANHYDRIDE;3,3-Dimethyladipic anhydride;4,4-Dimethyldihydro-2H-pyran-2,6(3H)-dione | | CAS: | 4160-82-1 | | MF: | C7H10O3 | | MW: | 142.15 | | EINECS: | 223-998-1 | | Product Categories: | Anhydride Monomers;Monomers;Polymer Science | | Mol File: | 4160-82-1.mol |  |
| | 3,3-DIMETHYLGLUTARIC ANHYDRIDE Chemical Properties |
| Melting point | 124-126 °C (lit.) | | Boiling point | 181 °C/25 mmHg (lit.) | | density | 1.1643 (rough estimate) | | refractive index | 1.4730 (estimate) | | Fp | 181°C/25mm | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | White to off-white | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C7H10O3/c1-7(2)3-5(8)10-6(9)4-7/h3-4H2,1-2H3 | | InChIKey | HIJQFTSZBHDYKW-UHFFFAOYSA-N | | SMILES | C1(=O)OC(=O)CC(C)(C)C1 | | CAS DataBase Reference | 4160-82-1(CAS DataBase Reference) | | EPA Substance Registry System | 2H-Pyran-2,6(3H)-dione, dihydro-4,4-dimethyl- (4160-82-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29171990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,3-DIMETHYLGLUTARIC ANHYDRIDE Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | 3,3-Dimethylglutaric Anhydride acts as a reagent for the synthesis of piscidinol A derivatives and their ability to inhibit HIV-1 protease. |
| | 3,3-DIMETHYLGLUTARIC ANHYDRIDE Preparation Products And Raw materials |
|