- BmPyPhB (B3PyPB)
-
- $0.00 / 1g
-
2025-12-22
- CAS:1030380-38-1
- Min. Order: 1g
- Purity: 99.7%
- Supply Ability: 100KGS
|
| | 1,3-bis[3,5-di(pyridin-3-yl)phenyl]benzene Basic information |
| Product Name: | 1,3-bis[3,5-di(pyridin-3-yl)phenyl]benzene | | Synonyms: | 3,5,3'',5''-Tetra-3-pyridyl-1,1';B 3PyPB;3,3'',5,5''-tetra(pyridin-3-yl)-1,1':3',1''-terphenyl;Pyridine, 3,3',3'',3'''-[1,1':3',1''-terphenyl]-3,3'',5,5''-tetrayltetrakis-;1,3-bis[3,5-di(pyridin-3-yl)phenyl]benzene ISO 9001:2015 REACH;BmPyPhB (B3PyPB);1,3-bis[3,5-di(pyridin-3-yl)phenyl]benzene | | CAS: | 1030380-38-1 | | MF: | C38H26N4 | | MW: | 538.64 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 1030380-38-1.mol | ![1,3-bis[3,5-di(pyridin-3-yl)phenyl]benzene Structure](CAS/20150408/GIF/1030380-38-1.gif) |
| | 1,3-bis[3,5-di(pyridin-3-yl)phenyl]benzene Chemical Properties |
| Melting point | 264-269°C | | Boiling point | 753.0±55.0 °C(Predicted) | | density | 1.186±0.06 g/cm3(Predicted) | | pka | 4.74±0.12(Predicted) | | form | powder | | InChI | 1S/C38H26N4/c1-6-27(33-17-35(29-8-2-12-39-23-29)21-36(18-33)30-9-3-13-40-24-30)16-28(7-1)34-19-37(31-10-4-14-41-25-31)22-38(20-34)32-11-5-15-42-26-32/h1-26H | | InChIKey | WCXKTQVEKDHQIY-UHFFFAOYSA-N | | SMILES | C1(C2=CC(C3=CC=CN=C3)=CC(C4=CN=CC=C4)=C2)=CC=CC(C5=CC(C6=CC=CN=C6)=CC(C7=CN=CC=C7)=C5)=C1 | | Fluorescene | λem?359 nm in?film | | color | White powder/crystals | | Absorption | λmax?259 nm in?film |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | 1,3-bis[3,5-di(pyridin-3-yl)phenyl]benzene Usage And Synthesis |
| | 1,3-bis[3,5-di(pyridin-3-yl)phenyl]benzene Preparation Products And Raw materials |
|