- SPhos Pd G3
-
- $1.10 / 1g
-
2025-11-18
- CAS:1445085-82-4
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- SPhos Pd G3
-
- $2.00 / 100kg
-
2025-10-13
- CAS:1445085-82-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| Product Name: | SPhos Pd G3 | | Synonyms: | Methanesulfonato(2-dicyclohexylphosphino-2',6'-diMethoxy-1,1'-biphenyl)(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) dichloroMethane adduct, Min. 98% [SPhos Palladacycle];Methanesulfonato(2-dicyclohexylphosphino-2',6'-diMethoxy-1,1'-biphenyl)(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) dichloroMethane adduct, Min. 98%;(2-Dicyclohexylphosphino-2',6'-dimethoxybiphenyl) [2-(2'-amino-1,1'-biphenyl)]palladium(II) methanesulfonate;[2'-(Amino-κN)[1,1'-biphenyl]-2-yl-κC][dicyclohexyl(2',6'-dimethoxy[1,1'-biphenyl]-2-yl)phosphine-κP](methanesulfonato-κO)palladium;Methanesulfonato(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)(2'-amino-1,1'-biphenyl-2-yl)palladium(II) min. 98% [SPhos Palladacycle Gen. 3];Methanesulfonato(2-Dicyclohexylphosphino-2',6'-dimethoxybiphenyl)(2'-amino-1,1'-biphenyl-2-yl)palladium(II);Methanesulfonato(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)(2'-amino-1,1'-biphenyl-2-yl)palladium(II)dichloromethane adduct;[2'-(Amino)[1,1'-biphenyl]-2-yl][dicyclohexyl(2',6'-dimethoxy[1,1'-biphenyl]-2-yl)phosphine](methanesulfonato)palladium | | CAS: | 1445085-82-4 | | MF: | C39H48NO5PPdS | | MW: | 780.27 | | EINECS: | | | Product Categories: | Buchwald Ligands&Precatalysts;Buchwald Precatalysts Series;Pd | | Mol File: | 1445085-82-4.mol |  |
| | SPhos Pd G3 Chemical Properties |
| Melting point | 197-214°C | | storage temp. | 2-8°C | | form | solid | | color | pale yellow | | InChIKey | RSFANHZWYCDNBZ-UHFFFAOYSA-N | | SMILES | CS(=O)(=O)O[Pd]c1ccccc1-c2ccccc2N.COc3cccc(OC)c3-c4ccccc4P(C5CCCCC5)C6CCCCC6 | | CAS DataBase Reference | 1445085-82-4 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | SPhos Pd G3 Usage And Synthesis |
| Reactions | Palladium precatalyst for the arylation of amines.
| | Description | SPhos Pd G3 is a common palladium catalyst ligand. As a third-generation composite palladium catalyst, SPhos Pd G3 is often used to catalyze Susuka-Miyaura, Buchwald-Hartwig, and other cross-coupling reactions. This product is used for organic synthesis, pharmaceutical research and development, and other scientific purposes. | | Chemical Properties | Palladium(II) methanesulfonate (2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenylyl)(2'-amino-1,1'-biphenyl-3-yl)is a yellowish-white solid at ambient temperature and pressure, and it is poorly soluble in water, but it is soluble in common organic solvents, especially in strong polar organic solvents. It is a stable palladium precatalyst linked to phosphine and is often used as a catalyst in coupling reactions. | | Uses | SPhos Pd G3 is stable phosphine-ligated palladium precatalyst that can be used in the catalysis of C-C and C-N bond formation reactions. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
| | SPhos Pd G3 Preparation Products And Raw materials |
|