|
|
| | 2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine Basic information | | Uses |
| Product Name: | 2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine | | Synonyms: | 2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine;2--1-1--biphenyl--4-yl--4-chloro-6-phenyl-1-3-5-triazine-manufacturer;2-(biphenyl-4-yl)-4-chloro-6-phenyl-1,3,5-triazine;1,3,5-Triazine, 2-[1,1'-biphenyl]-4-yl-4-chloro-6-phenyl-;1,3,5-Triazine, 2-[1,1'-biph;PBPTZ;2-(4-Biphenylyl)-4-chloro-6-phenyl-1,3,5-triazine;BPPTRZ-2Cl | | CAS: | 1472062-94-4 | | MF: | C21H14ClN3 | | MW: | 343.81 | | EINECS: | | | Product Categories: | | | Mol File: | 1472062-94-4.mol |  |
| | 2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine Chemical Properties |
| Melting point | 165 °C | | Boiling point | 571.6±43.0 °C(Predicted) | | density | 1.241±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | 0.05±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C21H14ClN3/c22-21-24-19(17-9-5-2-6-10-17)23-20(25-21)18-13-11-16(12-14-18)15-7-3-1-4-8-15/h1-14H | | InChIKey | JKHCVYDYGWHIFJ-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=CC=C2)N=C(Cl)N=C1C1=CC=C(C2=CC=CC=C2)C=C1 |
| | 2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine Usage And Synthesis |
| Uses | 2-Chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine is mainly used in pharmaceutical intermediates. | | Description | 2-([1,1'-Biphenyl]-4-yl)-4-chloro-6-phenyl-1,3,5-triazine, also called BPPTRZ-2Cl, PBPTZ and 2-(4-Biphenylyl)-4-chloro-6-phenyl-1,3,5-triazine, is a white powder that needs to be stored in the inert gas (nitrogen or argon) at 2-8 ° C. As a photoelectric material, it is often used as a bipolar material for synthesizing organic light emitting diodes. It can also be used as a material for thermally activated delayed fluorescence emitter[1]. | | Chemical Properties | white powder | | References | [1] S. Keigo. Organic Luminescent Molecule with Energetically Equivalent Singlet
and Triplet Excited States for Organic Light-Emitting Diodes. Phys. Rev. Lett., 2013; 110: 247401. |
| | 2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine Preparation Products And Raw materials |
|