- Sar-NCA
-
- $0.00/ kg
-
2026-05-19
- CAS:5840-76-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | 3-Methyl-2,5-oxazolidinedione Basic information |
| | 3-Methyl-2,5-oxazolidinedione Chemical Properties |
| Melting point | 99-100 °C | | Boiling point | 138.7±23.0 °C(Predicted) | | density | 1.373±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly) | | form | Solid | | pka | -2.08±0.20(Predicted) | | color | White | | InChI | InChI=1S/C4H5NO3/c1-5-2-3(6)8-4(5)7/h2H2,1H3 | | InChIKey | PMPAXURTFMSZSN-UHFFFAOYSA-N | | SMILES | O1C(=O)CN(C)C1=O |
| | 3-Methyl-2,5-oxazolidinedione Usage And Synthesis |
| Uses | 3-Methyl-2,5-oxazolidinedione is used in the preparation of amphiphilic polypeptoids. |
| | 3-Methyl-2,5-oxazolidinedione Preparation Products And Raw materials |
|