|
|
| | γ-Butyrolactone-13C4 Basic information |
| | γ-Butyrolactone-13C4 Chemical Properties |
| Boiling point | 204-205°C | | density | 1.17 g/mL at 25 °C | | InChI | 1S/C4H6O2/c5-4-2-1-3-6-4/h1-3H2/i1+1,2+1,3+1,4+1 | | InChIKey | YEJRWHAVMIAJKC-JCDJMFQYSA-N | | SMILES | O=[13C]1[13CH2][13CH2][13CH2]O1 |
| Hazard Codes | Xn | | Risk Statements | 20/22-36/38 | | Safety Statements | 26 | | WGK Germany | WGK 1 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 STOT SE 3 |
| | γ-Butyrolactone-13C4 Usage And Synthesis |
| Uses | Isotope Labelled γ-Butyrolactone, solvent for polyacrylonitrile, cellulose acetate, methyl methacrylate polymers, polystyrene. Constituent of paint removers, textile aids, drilling oils. |
| | γ-Butyrolactone-13C4 Preparation Products And Raw materials |
|