|
|
| | Methyl 2-cyano-3-methylcrotonate Basic information |
| Product Name: | Methyl 2-cyano-3-methylcrotonate | | Synonyms: | Methyl 2-cyano-3-methylbut-2-enoate;Methyl 2-cyano-3-methylcrotonate;2-cyano-3-methyl-2-butenoic acid methyl ester;Methyl 2-cyano-2-(isopropylidene)acetate;Methyl 2-cyano-3-methyl-2-butenoate;Methyl alpha-cyano-alpha-(isopropylidene)acetate;NSC 66529;2-Butenoic acid, 2-cyano-3-methyl-, methyl ester | | CAS: | 6666-75-7 | | MF: | C7H9NO2 | | MW: | 139.15 | | EINECS: | | | Product Categories: | | | Mol File: | 6666-75-7.mol |  |
| | Methyl 2-cyano-3-methylcrotonate Chemical Properties |
| storage temp. | 2-8°C | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C7H9NO2/c1-5(2)6(4-8)7(9)10-3/h1-3H3 | | InChIKey | UQJYFFMPKAPLJX-UHFFFAOYSA-N | | SMILES | C(OC)(=O)/C(/C#N)=C(/C)\C |
| | Methyl 2-cyano-3-methylcrotonate Usage And Synthesis |
| Uses | Methyl 2-Cyano-3-methylbut-2-enoate is used as a reactant in the preparation of pyrones and pyridines via cyclization of ylidenemalononitrile and ylidenecyanoacetate enamines. |
| | Methyl 2-cyano-3-methylcrotonate Preparation Products And Raw materials |
|