| Company Name: |
Shanghai CR Corporation Limited Gold
|
| Tel: |
13062833949; 4006653949 4006653949 |
| Email: |
fred.wen@crcorporation.cn |
| Products Intro: |
Product Name:Ramelteon Impurity P CAS:196597-27-0 Purity:95+
|
- (R)-Ramelteon
-
- $0.00 / 10mg
-
2026-01-23
- CAS:196597-27-0
- Min. Order: 10mg
- Purity: 0.98
- Supply Ability: 5g
|
| | (R)-Ramelteon Basic information |
| Product Name: | (R)-Ramelteon | | Synonyms: | PropanaMide, N-[2-[(8R)-1,6,7,8-tetrahydro-2H-indeno[5,4-b]furan-8-yl]ethyl]-;Ramelteon Impurity 20;(R)-Ramelteon;Ramelteon R-Isomer;N-{2-[(8R)-1H,2H,6H,7H,8H-indeno[5,4-b]furan-8-yl
]ethyl}propanamide;Ramelteon Impurity P;Ramelteon impurity 02;(R) -rametylamine | | CAS: | 196597-27-0 | | MF: | C16H21NO2 | | MW: | 259.34 | | EINECS: | | | Product Categories: | | | Mol File: | 196597-27-0.mol |  |
| | (R)-Ramelteon Chemical Properties |
| Boiling point | 455.3±24.0 °C(Predicted) | | density | 1.119±0.06 g/cm3(Predicted) | | pka | 16.37±0.46(Predicted) | | InChI | InChI=1S/C16H21NO2/c1-2-15(18)17-9-7-12-4-3-11-5-6-14-13(16(11)12)8-10-19-14/h5-6,12H,2-4,7-10H2,1H3,(H,17,18)/t12-/m1/s1 | | InChIKey | YLXDSYKOBKBWJQ-GFCCVEGCSA-N | | SMILES | C(NCC[C@@H]1C2=C3CCOC3=CC=C2CC1)(=O)CC |
| | (R)-Ramelteon Usage And Synthesis |
| Uses | (R)-Ramelteon is an enantiomer of Ramelteon (R110051), an Melatonin MT1/MT2 receptor agonist. Ramelteon is also known to exert sedative and hypnotic activities. |
| | (R)-Ramelteon Preparation Products And Raw materials |
|