|
|
| | (1S,3S)3aMinocyclopentan1ol hydrochloride Basic information | | Application |
| Product Name: | (1S,3S)3aMinocyclopentan1ol hydrochloride | | Synonyms: | (1S,3S)3aMinocyclopentan1ol hydrochloride;(1S,3S)-3-Aminocyclopentanol hydrochloride;(1S,3S)-3-AMINOCYCLOPENTANOL HCL;Bictegravir Impurity 17;Bikagwe impurity 23;(1S,3S)-3-Aminocyclopentan-1-ol HCl ee;Bictegravir Impurity 23;Bictegravir Impurity 4 HCl | | CAS: | 1523530-42-8 | | MF: | C5H12ClNO | | MW: | 137.61 | | EINECS: | | | Product Categories: | | | Mol File: | 1523530-42-8.mol |  |
| | (1S,3S)3aMinocyclopentan1ol hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | Brown to dark brown Solid | | InChI | InChI=1/C5H11NO.ClH/c6-4-1-2-5(7)3-4;/h4-5,7H,1-3,6H2;1H/t4-,5-;/s3 | | InChIKey | SGKRJNWIEGYWGE-TXRIQCMBNA-N | | SMILES | N[C@H]1CC[C@H](O)C1.Cl |&1:1,4,r| |
| | (1S,3S)3aMinocyclopentan1ol hydrochloride Usage And Synthesis |
| Application | (1S,3S)-3-aminocyclopentanol hydrochloride is a heterocyclic amine compound mainly used in organic synthesis. |
| | (1S,3S)3aMinocyclopentan1ol hydrochloride Preparation Products And Raw materials |
|